Jump to content

explain this for me, thanks!

Featured Replies

my book gives an example of how to find the concentration of OH- for transforming 99% benzoic acid to benzoate anion. it is difficult to understand how they get the answer, since there are no specified concentrations for the benzoic acid and benzoate anion, besides the way they write it is also difficult to understand. this is how they write:

 

the ability to separate a strong from weak acids depends on the acidity constants of the acids and the basicity constants of the bases as folllows. in the first equation, consider the ionization of benzoic acid, which has an equilibrium constant Ka of 6.8x10-5. the conversion of benzoic acid to the benzoate anion in the fourth equation is governed by the equilibrium constant K (Eq.5), obtained by the combining the third and fourth equations.

 

C6H5COOH + H2O -> <- C6H5COO- + H3O+ (Eq. 1)

 

Ka= [C6H5COO-][H3O+]/[C6H5COOH]=6.8x10-5, pKa=4.17 (Eq. 2)

 

Kw=[H3O+][OH- ]=10-14 (Eq. 3)

 

C6H5COOH + OH- -> <- C6H5COO- + H2O (Eq. 4)

 

K=[C6H5COO-]/[C6H5COOH][OH- ]=Ka/Kw=6.8x10-5/10-14=6.8x109 (Eq. 5)

 

if 99% of the benzoic acid is converted to C6H5COO- :

 

[C6H5COO-]/[C6H5COOH]=99/1 (Eq. 6)

 

then from Eq. 5 the hydroxide ion concentration would need to be 6.8x10-7M.

 

 

 

my question, how do they get [OH- ]= 6.8x10-7M ???? :eek:

 

 

hope for any ideas and guidance!

 

thanks for helping!

 

...and yes i have tried, but can not figure out how do they think.

Archived

This topic is now archived and is closed to further replies.

Important Information

We have placed cookies on your device to help make this website better. You can adjust your cookie settings, otherwise we'll assume you're okay to continue.

Configure browser push notifications

Chrome (Android)
  1. Tap the lock icon next to the address bar.
  2. Tap Permissions → Notifications.
  3. Adjust your preference.
Chrome (Desktop)
  1. Click the padlock icon in the address bar.
  2. Select Site settings.
  3. Find Notifications and adjust your preference.